Delphinidin nstates=150, three OH TPSSH
DOI: 10.14469/hpc/4500 Metadata
Created: 2018-06-18 13:20
Last modified: 2019-02-05 16:48
License: Creative Commons: Public Domain Dedication 1.0
Funding: (none given)
Description
Gaussian Calculation
Files
Filename | Size | Type | Description |
---|---|---|---|
input.gjf | 2KB | chemical/x-gaussian-input | Gaussian input file |
gaussian.log | 178KB | chemical/x-gaussian-log | Gaussian log file |
checkpoint.fchk | 12MB | chemical/x-gaussian-checkpoint | Formatted checkpoint file |
cml.xml | 4KB | application/xml | Optimised geometry |
wavefunction.wfn | 0 | chemical/x-gaussian-wavefunction | 'Wavefunction' |
Member of collection / collaboration
DOI | Description |
---|---|
10.14469/hpc/4473 | Why do flowers such as Red Roses, Peonies, Dahlias, Delphiniums, exhibit so many shades of colours? |
Subject Keywords
Keyword | Value |
---|---|
inchi | InChI=1S/C15H11O7.Br/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5,16-21H; |
inchikey | CHDDAJWETVIWGH-UHFFFAOYSA-N |