hydroxydiphenylborane
DOI: 10.14469/hpc/719 Metadata
Created: 2016-07-06 17:49
Last modified: 2024-11-03 14:33
License: Creative Commons: Public Domain Dedication 1.0
Funding: (none given)
Description
Gaussian Calculation
Files
| Filename | Size | Type | Description |
|---|---|---|---|
| input.gjf | 1KB | chemical/x-gaussian-input | Gaussian input file |
| gaussian.log | 601KB | chemical/x-gaussian-log | Gaussian log file |
| checkpoint.fchk | 8MB | chemical/x-gaussian-checkpoint | Formatted checkpoint file |
| cml.xml | 3KB | chemical/x-cml | Optimised geometry |
| wavefunction.wfn | 0 | chemical/x-gaussian-wavefunction | 'Wavefunction' |
| 6.zip | 992KB | application/zip | Bruker dataset |
| 6.mnpub | 0 | chemical/x-mnpub | Mestrenova signature file for 6.zip |
| 6.mnova | 400KB | chemical/x-mnova | MestreNova dataset |
| 6.mnpub | 0 | chemical/x-mnpub | Mestrenova signature file for 6.mnova |
| chemdraw.cdxml | 8KB | chemical/x-cdxml | Chemdraw representation |
| 6.pdf | 108KB | application/pdf | Acrobat spectrum |
Member of collection / collaboration
| DOI | Description |
|---|---|
| 10.14469/hpc/935 | 11B NMR chemical shifts computed at the wB97XD/aug-cc-pvDZ/SCRF=solvent method. |
Associated DOIs
| Current dataset ... | DOI | Description |
|---|---|---|
| References | 10.1002/mrc.3854 | Literature references for 11B NMR data |
Subject Keywords
| Keyword | Value |
|---|---|
| inchi | InChI=1S/C12H11BO/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| inchikey | VIGVRXYWWFPORY-UHFFFAOYSA-N |
| NMR_Expt | 1D |
| NMR_Nucleus | 1H |