A mechanistic insight into the boron-catalysed direct amidation reaction. Crystal structures
DOI: 10.14469/hpc/2248 Metadata
Created: 2017-03-15 10:30
Last modified: 2021-04-24 15:54
License: Creative Commons: Public Domain Dedication 1.0
Funding: (none given)
Co-author: Andrei Batsanov Co-author: Andrew Whiting Co-author: Marco Sabatini Co-author: Tom Sheppard Co-author: Valerija Karaluka
Description
A mechanistic insight into the boron-catalysed direct amidation reaction
Member of collection / collaboration
| DOI | Description |
|---|---|
| 10.14469/hpc/1620 | A mechanistic insight into the boron-catalysed direct amidation reaction |
Members
| DOI | Description |
|---|---|
| 10.14469/hpc/2755 | Bis-3,4,5-trifluorophenylborinic_acid_benzylamine_complex |
| 10.14469/hpc/2756 | Bis-3,4,5-trifluorophenylborinic_acid_ethylenediamine complex |
| 10.14469/hpc/2757 | Bis(3,4,5-trifluorophenyl)-borinic acid benzylamine-4'-phenylbutanoate |
| 10.14469/hpc/2758 | Bis(3,4,5-trifluorophenyl)-borinic_acid_benzylaminobenzoate |
| 10.14469/hpc/2759 | Bis-(phenyl)borinic_acid_benzylaminobenzoate |
| 10.14469/hpc/2760 | Bis-(2-chlorophenyl)borinic_acid_benzylamine-4-phenylbutanoate |
| 10.14469/hpc/2761 | 3,4,5-Trifluorophenylboroxine benzylamine complex |
| 10.14469/hpc/2764 | phenylboroxine complex with 2 equiv. benzylamine |
| 10.14469/hpc/2765 | phenylboroxine complex with 4 equiv. benzylamine |
| 10.14469/hpc/2767 | Di-2-chlorophenylboronic_B-O-B_di-2-phenylacetate |
| 10.14469/hpc/2768 | Di-2-iodophenylboronic B-O-B di-2-phenylacetate |
| 10.14469/hpc/2769 | 3,4,5-trifluorophenylboroxine |
| 10.14469/hpc/2770 | 3,4,5-trifluorophenylboroxine |
| 10.14469/hpc/2771 | 3,4,5-trifluorophenylboroxine |
| 10.14469/hpc/2772 | Bis-(3,4,5-trifluorophenyl)borinic acid ethanolamine complex |
| 10.14469/hpc/2773 | Bis-(2-chlorophenyl)borinic acid ethanolamine complex |
| 10.14469/hpc/2774 | Bis-(2-chloro-4-fluorophenyl)borinic acid ethanolamine complex |