NMR data for compound 3. N-benzylbenzamide. 13C
DOI: 10.14469/hpc/14638 Metadata
Created: 2024-10-02 10:33
Last modified: 2024-10-24 07:20
License: Creative Commons: Public Domain Dedication 1.0
Funding: (none given)
Co-author: Richard Procter
Description
Primary NMR Data from Bruker spectrometer
Files
| Filename | Size | Type | Description |
|---|---|---|---|
| 3-13C-Bruker.zip | 1MB | application/zip | Bruker data archive from Spectrometer |
| 3-13C-Bruker.mnpub | 0 | chemical/x-mnpub | Mestrenova signature file for 3-13C-Bruker.zip |
| 3-13C.zip | 1MB | application/zip | Bruker data archive processed by TopSpin |
| 3-13C.mnpub | 0 | chemical/x-mnpub | Mestrenova signature file for 3-13C.zip |
| 3-13C.mnova | 423KB | chemical/x-mnova | MestreNova data archive |
| 3-13C.mnpub | 0 | chemical/x-mnpub | Mestrenova signature file for 3-13C.mnova |
| 3-13C.jdx | 207KB | chemical/x-jcamp-dx | JCAMP-DX Spectrum |
| 3-13C.pdf | 20KB | application/pdf | PDF Spectrum |
| 3.cdxml | 4KB | chemical/x-cdxml | Chemdraw structure representation. |
| 3.png | 23KB | image/png | Structure representation as image |
Member of collection / collaboration
| DOI | Description |
|---|---|
| 10.14469/hpc/14636 | NMR data for compound 3. N-benzylbenzamide |
Subject Keywords
| Keyword | Value |
|---|---|
| inchi | InChI=1S/C14H13NO/c16-14(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,15,16) |
| inchikey | LKQUCICFTHBFAL-UHFFFAOYSA-N |
| NMR_Expt | 1D |
| NMR_Nucleus | 13C |
| NMR_Solvent | CDCl3 |