Operando film-electrochemical EPR spectroscopy tracks radical intermediates in surface-immobilised catalysts - DATA
DOI: 10.14469/hpc/13519 Metadata
Created: 2023-12-20 11:30
Last modified: 2024-01-29 15:00
License: Creative Commons: Public Domain Dedication 1.0
Funding: (none given)
Description
Source data for the publication "Operando film-electrochemical EPR spectroscopy tracks radical intermediates in surface-immobilised catalysts" in Nature Chemistry Authors: Maryam Seif-Eddine, Samuel J. Cobb, Yunfei Dang, Kaltum Abdiaziz, Mark A. Bajada, Erwin Reisner, Maxie M. Roessler
Embargo
Access code: vqa5-quxh
Files
| Filename | Size | Type | Description |
|---|---|---|---|
| FigS1-1_mesoOld_01.png | 91KB | image/png | Figure S1 |
| FigS1-1_mesoOld_01.tif | 887KB | image/tiff | Figure S1 |
| FigS1-2_mesoOld_07.png | 117KB | image/png | Figure S1 |
| FigS1-2_mesoOld_07.tif | 887KB | image/tiff | Figure S1 |
| FigS1-3_newMesoITO-WE2-2_13.tif | 2MB | image/tiff | Figure S1 |
| FigS1-3_newMesoITO-WE2-2_13_process.png | 375KB | image/png | Figure S1 |
| FigS2.opju | 2MB | application/octet-stream | Figure S2 |
| FigS2.pdf | 5MB | application/pdf | Figure S2 |
| FigS2.pptx | 4MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S2 |
| FigS2A.tif | 31MB | image/tiff | Figure S2 |
| FigS2A.xlsx | 225KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S2 |
| FigS2B.tif | 31MB | image/tiff | Figure S2 |
| FigS2B.xlsx | 28KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S2 |
| CV_eleccell_23 10mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 80KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S3 |
| FigS3.m | 671 | application/vnd.wolfram.mathematica.package | Figure S3 |
| FigS3.tif | 80KB | image/tiff | Figure S3 |
| FigS3.txt | 671 | text/plain | Figure S3 |
| CV_eleccell_01 100Vps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_02 125mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 114KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_03 150mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_04 175mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_05 200mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 78KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_06 225mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_07 250mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 78KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_08 275mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_09 300mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_10 325mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_11 350mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_12 375mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_13 400mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 78KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_14 100mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_15 90mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 80KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_16 80mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_17 70mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 80KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_18 60mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_19 50mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 80KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| CV_eleccell_20 40mVps pH8 500mMNa2CO3 AgAgCl.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S4 |
| FigS4.pdf | 261KB | application/pdf | Figure S4 |
| FigS4.pptx | 328KB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S4 |
| FigS4_CVscript_LavironAnalysis.m | 13KB | application/vnd.wolfram.mathematica.package | Figure S4 |
| FigS4_CVscript_LavironAnalysis.txt | 13KB | text/plain | Figure S4 |
| FigS4a.fig | 513KB | application/x-xfig | Figure S4 |
| FigS4a.tif | 372KB | image/tiff | Figure S4 |
| FigS4b.fig | 101KB | application/x-xfig | Figure S4 |
| FigS4b.tif | 75KB | image/tiff | Figure S4 |
| FigS4c_supporting.fig | 482KB | application/x-xfig | Figure S4 |
| FigS4c.fig | 330KB | application/x-xfig | Figure S4 |
| FigS4c.tif | 70KB | image/tiff | Figure S4 |
| Data_FigS5.xlsx | 51KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S5 |
| FigS5.opju | 73KB | application/octet-stream | Figure S5 |
| FigS5.tif | 31MB | image/tiff | Figure S5 |
| Unprocessed_CV_flowdir1-2.xlsx | 160KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S5 |
| Data_FigS6C.xlsx | 10KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S6 |
| FigS6_EIS.pptx | 34MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S6 |
| FigS6.pdf | 438KB | application/pdf | Figure S6 |
| FigS6C.opju | 181KB | application/octet-stream | Figure S6 |
| FigS6C.tif | 31MB | image/tiff | Figure S6 |
| EIS_oldelec_flow4_dir1_REposdown3_C01.mpt | 27KB | application/vnd.ms-project | Figure S6 |
| EIS_oldelec_flow4_dir2_REposdown3_C01.mpt | 28KB | application/vnd.ms-project | Figure S6 |
| Data_FigS7.xlsx | 64KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S7 |
| FigS7.opju | 203KB | application/octet-stream | Figure S7 |
| FigS7.tif | 31MB | image/tiff | Figure S7 |
| CV_STEMPO_01 underN2highpurge flow1 20mVps -0p8to1V 1sc.xlsx | 91KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S7 |
| CV_STEMPO_01 underO2 flow1 20mVps -0p8to1V 1sc.xlsx | 90KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S7 |
| CVblank_02 underO2 20mVps -0p8to1V 2sc.xlsx | 90KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S7 |
| CVblank_05 underN2 20mVps -0p8to1V 2sc.xlsx | 90KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S7 |
| STEMPO_10.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_10.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_10.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_11.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_11.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_11.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_12.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_12.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_12.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_13.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_13.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_13.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_14.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_14.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_14.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_15.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_15.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_15.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_16.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_16.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_17.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_17.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_17.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_18.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_18.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_18.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_19.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_19.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_19.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_20.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_20.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_20.DTA | 6KB | application/octet-stream | Figure S8 |
| STEMPO_21.DSC | 3KB | application/octet-stream | Figure S8 |
| STEMPO_21.DSC.txt | 29KB | text/plain | Figure S8 |
| STEMPO_21.DTA | 6KB | application/octet-stream | Figure S8 |
| Data_FigS8.xlsx | 9KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S8 |
| FigS8_SaturationPower.opju | 52KB | application/octet-stream | Figure S8 |
| FigS8.pdf | 48KB | application/pdf | Figure S8 |
| FigS8.pptx | 777KB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S8 |
| FigS8.tif | 31MB | image/tiff | Figure S8 |
| FigS9.opju | 259KB | application/octet-stream | Figure S9 |
| FigureS9.tif | 31MB | image/tiff | Figure S9 |
| Processed_data_FigS9.xlsx | 53KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S9 |
| STEMPO_11HS.DSC | 3KB | application/octet-stream | Figure S9 |
| STEMPO_11HS.DSC.txt | 39KB | text/plain | Figure S9 |
| STEMPO_11HS.DTA | 8KB | application/octet-stream | Figure S9 |
| STEMPO_13HS.DSC | 3KB | application/octet-stream | Figure S9 |
| STEMPO_13HS.DSC.txt | 39KB | text/plain | Figure S9 |
| STEMPO_13HS.DTA | 8KB | application/octet-stream | Figure S9 |
| AminoTEMPO_5uM.DSC | 3KB | application/octet-stream | Figure S10 |
| AminoTEMPO_5uM.DSC.txt | 81KB | text/plain | Figure S10 |
| AminoTEMPO_5uM.DTA | 16KB | application/octet-stream | Figure S10 |
| AminoTEMPO_10mM.DSC | 3KB | application/octet-stream | Figure S10 |
| AminoTEMPO_10mM.DSC.txt | 81KB | text/plain | Figure S10 |
| AminoTEMPO_10mM.DTA | 16KB | application/octet-stream | Figure S10 |
| AminoTEMPO_10uM.DSC | 3KB | application/octet-stream | Figure S10 |
| AminoTEMPO_10uM.DSC.txt | 81KB | text/plain | Figure S10 |
| AminoTEMPO_10uM.DTA | 16KB | application/octet-stream | Figure S10 |
| AminoTEMPO_50uM.DSC | 3KB | application/octet-stream | Figure S10 |
| AminoTEMPO_50uM.DSC.txt | 81KB | text/plain | Figure S10 |
| AminoTEMPO_50uM.DTA | 16KB | application/octet-stream | Figure S10 |
| AminoTEMPO_100uM.DSC | 3KB | application/octet-stream | Figure S10 |
| AminoTEMPO_100uM.DSC.txt | 81KB | text/plain | Figure S10 |
| AminoTEMPO_100uM.DTA | 16KB | application/octet-stream | Figure S10 |
| Data_FigS10.xlsx | 9KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S10 |
| FigS10_Calibrationcurve.opju | 203KB | application/octet-stream | Figure S10 |
| FigS10.tif | 31MB | image/tiff | Figure S10 |
| Data_FigS11A_for.xlsx | 130KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S11 |
| Data_FigS11A_rev.xlsx | 124KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S11 |
| Data_FigS11B_for.xlsx | 126KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S11 |
| Data_FigS11B_rev.xlsx | 127KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S11 |
| FigS11.pdf | 12MB | application/pdf | Figure S11 |
| FigS11.pptx | 11MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S11 |
| FigS11A_for.tif | 31MB | image/tiff | Figure S11 |
| FigS11A_MBA_FEcvEPR.opju | 982KB | application/octet-stream | Figure S11 |
| FigS11A_rev.tif | 31MB | image/tiff | Figure S11 |
| FigS11B_for.tif | 31MB | image/tiff | Figure S11 |
| FigS11B_Gly_FEcvEPR.opju | 936KB | application/octet-stream | Figure S11 |
| FigS11B_rev.tif | 31MB | image/tiff | Figure S11 |
| CVEPR_STEMPO_02 N2 nosub flow1 5mVps 0p2to1V 2sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| CVEPR_STEMPO_02.DSC | 3KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_02.DTA | 8MB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_02.YGF | 8KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_03 N2 1mM flow1 5mVps 0p2to1V 2sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| CVEPR_STEMPO_03.DSC | 3KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_03.DTA | 8MB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_03.YGF | 8KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_04 N2 5mM flow1 5mVps 0p2to1V 1sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| CVEPR_STEMPO_04.DSC | 3KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_04.DTA | 8MB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_04.YGF | 8KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_05 N2 10mM flow1 5mVps 0p2to1V 1sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| CVEPR_STEMPO_05.DSC | 3KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_05.DTA | 8MB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_05.YGF | 8KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_06 N2 20mM flow1 5mVps 0p2to1V 1sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| CVEPR_STEMPO_06.DSC | 3KB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_06.DTA | 8MB | application/octet-stream | Figure S12 |
| CVEPR_STEMPO_06.YGF | 8KB | application/octet-stream | Figure S12 |
| Data_FigS12A.xlsx | 8KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| Data_FigS12B.xlsx | 8KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S12 |
| FigS12.pdf | 5MB | application/pdf | Figure S12 |
| FigS12.pptx | 4MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S12 |
| FigS12A_MBA_FEcvEPR.opju | 4MB | application/octet-stream | Figure S12 |
| FigS12A.tif | 31MB | image/tiff | Figure S12 |
| FigS12B.tif | 31MB | image/tiff | Figure S12 |
| Figure S12B.opju | 46KB | application/octet-stream | Figure S12 |
| Data_FigS13A.xlsx | 12KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S13 |
| Data_FigS13B.xlsx | 21KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S13 |
| FigS13.pdf | 5MB | application/pdf | Figure S13 |
| FigS13.pptx | 4MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S13 |
| FigS13A.tif | 31MB | image/tiff | Figure S13 |
| FigS13B.tif | 31MB | image/tiff | Figure S13 |
| FigureS13A.opju | 57KB | application/octet-stream | Figure S13 |
| FigureS13B.opju | 55KB | application/octet-stream | Figure S13 |
| Data_FigS14.xlsx | 135KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S14 |
| FigS14_0mM.tif | 31MB | image/tiff | Figure S14 |
| FigS14_1mM.tif | 31MB | image/tiff | Figure S14 |
| FigS14_5mM.tif | 31MB | image/tiff | Figure S14 |
| FigS14_10mM.tif | 31MB | image/tiff | Figure S14 |
| FigS14_20mM.tif | 31MB | image/tiff | Figure S14 |
| FigS14.pdf | 13MB | application/pdf | Figure S14 |
| FigS14.pptx | 12MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S14 |
| FigureS14.opju | 901KB | application/octet-stream | Figure S14 |
| Data_FigS15.xlsx | 36KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S15 |
| FigS15.opju | 1MB | application/octet-stream | Figure S15 |
| FigS15.tif | 31MB | image/tiff | Figure S15 |
| Data_FigS16.xlsx | 119KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S16 |
| FigS16_0mM.tif | 31MB | image/tiff | Figure S16 |
| FigS16_1mM.tif | 31MB | image/tiff | Figure S16 |
| FigS16_5mM.tif | 31MB | image/tiff | Figure S16 |
| FigS16_10mM.tif | 31MB | image/tiff | Figure S16 |
| FigS16.opju | 747KB | application/octet-stream | Figure S16 |
| FigS16.pdf | 10MB | application/pdf | Figure S16 |
| FigS16.pptx | 9MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S16 |
| FigS16.tif | 31MB | image/tiff | Figure S16 |
| Data_FigS17.xlsx | 152KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S17 |
| FigS17_0mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17_1mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17_2p4mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17_6p8mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17_10mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17_20mM.tif | 31MB | image/tiff | Figure S17 |
| FigS17.pdf | 15MB | application/pdf | Figure S17 |
| FigS17.pptx | 14MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S17 |
| FigureS17.opju | 3MB | application/octet-stream | Figure S17 |
| Data_FigS18.xlsx | 19KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S18 |
| FigS18.tif | 31MB | image/tiff | Figure S18 |
| FigureS18.opju | 69KB | application/octet-stream | Figure S18 |
| FigS19.pdf | 5MB | application/pdf | Figure S19 |
| FigS19.pptx | 5MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure S19 |
| Figure S23.svg | 726KB | image/svg+xml | Figure S23 |
| Figure S23a.oggu | 810KB | application/octet-stream | Figure S23 |
| Figure S23b.oggu | 19KB | application/octet-stream | Figure S23 |
| Figure S23.xlsx | 1MB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S23 |
| FigS24.png | 523KB | image/png | Figure S24 |
| FigS24.svg | 634KB | image/svg+xml | Figure S24 |
| Figure S24.xlsx | 121KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S24 |
| FigS25.png | 562KB | image/png | Figure S25 |
| FigS25.svg | 939KB | image/svg+xml | Figure S25 |
| FigS25a.oggu | 91KB | application/octet-stream | Figure S25 |
| Figs25b.oggu | 85KB | application/octet-stream | Figure S25 |
| Figure s25A.xlsx | 128KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S25 |
| FIgure S25b.xlsx | 122KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S25 |
| FigS26.opju | 31KB | application/octet-stream | Figure S26 |
| FigS26.png | 158KB | image/png | Figure S26 |
| FigS26.xlsx | 8KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S26 |
| FigS27.svg | 171KB | image/svg+xml | Figure S27 |
| FigS27a.oggu | 40KB | application/octet-stream | Figure S27 |
| FigS27b.oggu | 26KB | application/octet-stream | Figure S27 |
| FigS27.csv | 36KB | text/csv | Figure S27 |
| FigS28.oggu | 103KB | application/octet-stream | Figure S28 |
| FigS28.svg | 156KB | image/svg+xml | Figure S28 |
| Fig S28.xlsx | 145KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S28 |
| FigS29.png | 292KB | image/png | Figure S29 |
| FigS29.svg | 120KB | image/svg+xml | Figure S29 |
| FigS29a.oggu | 32KB | application/octet-stream | Figure S29 |
| FigS29b.oggu | 25KB | application/octet-stream | Figure S29 |
| FigS29c.oggu | 15KB | application/octet-stream | Figure S29 |
| Figure S29.xlsx | 51KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S29 |
| Ext_Fig1.txt | 980 | text/plain | Extended Figure 1 |
| Ext_Fig1.m | 980 | application/vnd.wolfram.mathematica.package | Extended Figure 1 |
| Ext_Fig1.pdf | 78KB | application/pdf | Extended Figure 1 |
| Ext_Fig1.tif | 312KB | image/tiff | Extended Figure 1 |
| FE-EPR_01_100mVps.xlsx | 111KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 1 |
| FE-EPR_02_75mVps.xlsx | 77KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 1 |
| FE-EPR_03_50mVps.xlsx | 77KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 1 |
| FE-EPR_04_25mVps.xlsx | 79KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 1 |
| FE-EPR_05_5mVps.xlsx | 43KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 1 |
| Ext_Fig2_processed_data.xlsx | 53KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 2 |
| Ext_Fig2.opju | 264KB | application/octet-stream | Extended Figure 2 |
| Ext_Fig2.tif | 31MB | image/tiff | Extended Figure 2 |
| STEMPO_11HS.DSC | 3KB | application/octet-stream | Extended Figure 2 |
| STEMPO_11HS.DSC.txt | 39KB | text/plain | Extended Figure 2 |
| STEMPO_11HS.DTA | 8KB | application/octet-stream | Extended Figure 2 |
| STEMPO_13HS.DSC | 3KB | application/octet-stream | Extended Figure 2 |
| STEMPO_13HS.DSC.txt | 39KB | text/plain | Extended Figure 2 |
| STEMPO_13HS.DTA | 8KB | application/octet-stream | Extended Figure 2 |
| Ext_Fig3.opju | 799KB | application/octet-stream | Extended Figure 3 |
| Ext_Fig3.tif | 31MB | image/tiff | Extended Figure 3 |
| Ext_Fig3_Data.xlsx | 1MB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 3 |
| ED_Fig4.svg | 530KB | image/svg+xml | Extended Figure 4 |
| EDFig4a.oggu | 230KB | application/octet-stream | Extended Figure 4 |
| EDFig4b.oggu | 30KB | application/octet-stream | Extended Figure 4 |
| EDFig4c.oggu | 20KB | application/octet-stream | Extended Figure 4 |
| Ext_Fig4.png | 924KB | image/png | Extended Figure 4 |
| Extended_data_Fig_4a-Sim.xlsx | 311KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 4 |
| Extended_data_Fig_4b-Sim.xlsx | 10KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 4 |
| Extended_data_Fig_4c-Sim.xlsx | 10KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 4 |
| Ext_Fig5.pptx | 42KB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Extended Figure 5 |
| Ext_Fig5.pdf | 72KB | application/pdf | Extended Figure 5 |
| Ext_Fig5.tif | 483KB | image/tiff | Extended Figure 5 |
| Ext_Fig6_Data.xlsx | 1MB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 6 |
| Ext_Fig6.opju | 780KB | application/octet-stream | Extended Figure 6 |
| Ext_Fig6.tif | 31MB | image/tiff | Extended Figure 6 |
| EDFig7_proofs.svg | 290KB | image/svg+xml | Extended Figure 7 |
| EDFig7.svg | 290KB | image/svg+xml | Extended Figure 7 |
| Ext_Fig7_proofs.png | 478KB | image/png | Extended Figure 7 |
| EDFig7a.oggu | 82KB | application/octet-stream | Extended Figure 7 |
| EDFig7b.oggu | 82KB | application/octet-stream | Extended Figure 7 |
| Ext_Fig7.png | 474KB | image/png | Extended Figure 7 |
| Extended_Data_Figure 7a.xlsx | 142KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 7 |
| Extended_Data_Figure 7b.xlsx | 142KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 7 |
| Ext_Fig8.opju | 1MB | application/octet-stream | Extended Figure 8 |
| Ext_Fig8b.tif | 31MB | image/tiff | Extended Figure 8 |
| Ext_Fig8_Data.xlsx | 94KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 8 |
| Ext_Fig8.pdf | 696KB | application/pdf | Extended Figure 8 |
| Ext_Fig8.pptx | 95MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Extended Figure 8 |
| Ext_Fig8.tif | 925KB | image/tiff | Extended Figure 8 |
| Ext_Fig8A.tif | 31MB | image/tiff | Extended Figure 8 |
| ED_Fig9_proof.png | 1MB | image/png | Extended Figure 9 |
| ED_Fig9_proof.svg | 624KB | image/svg+xml | Extended Figure 9 |
| Ext_Fig9_Data.xlsx | 115KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 9 |
| Ext_Fig9.opju | 1MB | application/octet-stream | Extended Figure 9 |
| Ext_Fig9.pdf | 5MB | application/pdf | Extended Figure 9 |
| Ext_Fig9.pptx | 5MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Extended Figure 9 |
| Ext_Fig9.tif | 732KB | image/tiff | Extended Figure 9 |
| Ext_Fig9A.tif | 31MB | image/tiff | Extended Figure 9 |
| Ext_Fig9B.tif | 31MB | image/tiff | Extended Figure 9 |
| EDFig10a.oggu | 146KB | application/octet-stream | Extended Figure 10 |
| EDFig10b.oggu | 146KB | application/octet-stream | Extended Figure 10 |
| EDFig10cd.oggu | 107KB | application/octet-stream | Extended Figure 10 |
| Ext_Fig10.png | 1MB | image/png | Extended Figure 10 |
| Extended_Data_Figure10.xlsx | 441KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Extended Figure 10 |
| Figure1.pdf | 217KB | application/pdf | Figure 1 |
| Figure1.pptx | 55KB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure 1 |
| Fig2 1.eps | 11KB | application/postscript | Figure 2 |
| Fig2 2.eps | 5KB | application/postscript | Figure 2 |
| Fig2 3.eps | 5KB | application/postscript | Figure 2 |
| Figure 2.pdf | 28MB | application/pdf | Figure 2 |
| Figure2.tif | 3MB | image/tiff | Figure 2 |
| Figure2c_SEM.tif | 3MB | image/tiff | Figure 2 |
| Figure3c_confocal.pdf | 5MB | application/pdf | Figure 2 |
| WE2nd_afterSEM_7_LSM_1_3D.mnt | 1MB | application/octet-stream | Figure 2 |
| Figure2c_confocal.png | 21MB | image/png | Figure 2 |
| WE2nd_afterSEM_7_LSM_1.czi | 40MB | application/octet-stream | Figure 2 |
| WE2nd_05_scale.png | 3MB | image/png | Figure 2 |
| CVEPR_STEMPO_02_nosubs_O2_flow4_5mVps_0p2to1V_1sc.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| CVEPR_ProcessedData_for.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| CVEPR_ProcessedData_rev.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| CVEPR_STEMPO_02.DSC | 3KB | application/octet-stream | Figure 3 |
| CVEPR_STEMPO_02.DTA | 8MB | application/octet-stream | Figure 3 |
| CVEPR_STEMPO_02.YGF | 8KB | application/octet-stream | Figure 3 |
| EPRdata_for.xlsx | 578KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| EPRdata_rev.xlsx | 580KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| Fig3a_echem.xlsx | 45KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| Fig3b_EPRspectra_forward-and-reverse.xlsx | 224KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| Fig3c_Forward-data_Nernstfitting.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| Fig3c_Reverse-data_Nernestfitting.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 3 |
| Fig3.pdf | 5MB | application/pdf | Figure 3 |
| Fig3.pptx | 99MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure 3 |
| Fig3A.tif | 31MB | image/tiff | Figure 3 |
| Fig3ABC.opju | 1MB | application/octet-stream | Figure 3 |
| Fig3B_forward.tif | 31MB | image/tiff | Figure 3 |
| Fig3B_reverse.tif | 31MB | image/tiff | Figure 3 |
| Fig3C_forward.tif | 31MB | image/tiff | Figure 3 |
| Fig3C_revverse.tif | 31MB | image/tiff | Figure 3 |
| Fig4abc_echem.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| FE-EPR_06.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_06.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_06.YGF | 8KB | application/octet-stream | Figure 4 |
| Fig4abc_CVEPR_ProcessedData_for.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4abc_CVEPR_ProcessedData_rev.xlsx | 7KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4abc_EPRdata_for.xlsx | 547KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4abc_EPRdata_rev.xlsx | 549KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4d_FE-EPR_02_0mMMBA.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4d_FE-EPR_03_1mMMBA.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4d_FE-EPR_04_5mMMBA.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4d_FE-EPR_05_10mMMBA.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4d_FE-EPR_06_20mMMBA.xlsx | 44KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| FE-EPR_02.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_02.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_02.YGF | 8KB | application/octet-stream | Figure 4 |
| FE-EPR_03.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_03.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_03.YGF | 8KB | application/octet-stream | Figure 4 |
| FE-EPR_04.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_04.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_04.YGF | 8KB | application/octet-stream | Figure 4 |
| FE-EPR_05.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_05.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_05.YGF | 8KB | application/octet-stream | Figure 4 |
| FE-EPR_06.DSC | 3KB | application/octet-stream | Figure 4 |
| FE-EPR_06.DTA | 8MB | application/octet-stream | Figure 4 |
| FE-EPR_06.YGF | 8KB | application/octet-stream | Figure 4 |
| Fig4E_Data.xlsx | 130KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 4 |
| Fig4_ABCDE.opju | 1MB | application/octet-stream | Figure 4 |
| Fig4.pdf | 15MB | application/pdf | Figure 4 |
| Fig4.pptx | 13MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure 4 |
| Fig4A.tif | 31MB | image/tiff | Figure 4 |
| Fig4B_for.tif | 31MB | image/tiff | Figure 4 |
| Fig4B_rev.tif | 31MB | image/tiff | Figure 4 |
| Fig4C_for.tif | 31MB | image/tiff | Figure 4 |
| Fig4C_rev.tif | 31MB | image/tiff | Figure 4 |
| Fig4D.tif | 31MB | image/tiff | Figure 4 |
| Fig4E.tif | 31MB | image/tiff | Figure 4 |
| Chronoamp-EPR_01_0p4-100s_0p8-100s_stop-1.xlsx | 417KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_01_0p4-100s_0p8-100s_stop-2.xlsx | 374KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_02_1mMMBA_0p4-100s_0p8-100s_stop-1.xlsx | 419KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_02_1mMMBA_0p4-100s_0p8-100s_stop-2.xlsx | 373KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_03_5MMBA_0p4-100s_0p8-100s_stop-1.xlsx | 419KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_03_5MMBA_0p4-100s_0p8-100s_stop-2.xlsx | 376KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_04_10MMBA_0p4-100s_0p8-100s_stop-1.xlsx | 419KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_04_10MMBA_0p4-100s_0p8-100s_stop-2.xlsx | 357KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_05_20MMBA_0p4-100s_0p8-100s_stop-1.xlsx | 420KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_05_20MMBA_0p4-100s_0p8-100s_stop-2.xlsx | 360KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Chronoamp-EPR_01.DSC | 3KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_01.DTA | 8MB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_01.YGF | 8KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_02.DSC | 3KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_02.DTA | 8MB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_02.YGF | 8KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_03.DSC | 3KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_03.DTA | 8MB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_03.YGF | 8KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_04.DSC | 3KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_04.DTA | 8MB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_04.YGF | 8KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_05.DSC | 3KB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_05.DTA | 8MB | application/octet-stream | Figure 5 |
| Chronoamp-EPR_05.YGF | 8KB | application/octet-stream | Figure 5 |
| ChronoampEPR_pg_final.m | 4KB | application/vnd.wolfram.mathematica.package | Figure 5 |
| rawdata_ChronoampEPR_01.xlsx | 5KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| rawdata_ChronoampEPR_02.xlsx | 5KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| rawdata_ChronoampEPR_03.xlsx | 5KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| rawdata_ChronoampEPR_04.xlsx | 5KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| rawdata_ChronoampEPR_05.xlsx | 5KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Fig5_data.xlsx | 81KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure 5 |
| Fig5.opju | 378KB | application/octet-stream | Figure 5 |
| Fig5.pdf | 5MB | application/pdf | Figure 5 |
| Fig5.pptx | 5MB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure 5 |
| Fig5A.tif | 31MB | image/tiff | Figure 5 |
| Fig5B.tif | 31MB | image/tiff | Figure 5 |
| Figure6.pdf | 40KB | application/pdf | Figure 6 |
| Figure6.pptx | 87KB | application/vnd.openxmlformats-officedocument.presentationml.presentation | Figure 6 |
| Fig6 1.eps | 7KB | application/postscript | Figure 6 |
| Fig6 2.eps | 8KB | application/postscript | Figure 6 |
| Fig6 3.eps | 7KB | application/postscript | Figure 6 |
| Fig6 4.eps | 7KB | application/postscript | Figure 6 |
| Fig6 5.eps | 8KB | application/postscript | Figure 6 |
| Fig6 6.eps | 8KB | application/postscript | Figure 6 |
| Fig6_ChemDraw.cdx | 7KB | chemical/x-cdx | Figure 6 |
| Figure6.tif | 526KB | image/tiff | Figure 6 |
| 0907ChroEPR04_pH8_MBA20mM_0p4V300s_0p9V300s_OCP600s_flow40.nox | 9MB | application/octet-stream | Figure S20 |
| 0907ChroEPR03_pH8_noCata_0p4V300s_0p9V300s_OCP600s_flow40.nox | 9MB | application/octet-stream | Figure S20 |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_001-1-Blank.PDF | 268KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_002-D2F-F1-freshCO3pH8_1.PDF | 321KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_003-D2F-F2-Cata_0p9V.PDF | 174KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_004-D2F-F3-Cata_0p4V.PDF | 154KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_005-D2F-F4-unusedMBA20.PDF | 155KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_006-D2F-F1-freshCO3pH8_3.PDF | 186KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_007-D2F-F5-noCata_0p9V.PDF | 165KB | application/octet-stream | Figure S20 HPLC |
| 2023-09-07_newSTEMPO_0p9VProduct_re 2023-09-07 15-17-08_008-D2F-F6-noCata_0p4V.PDF | 193KB | application/octet-stream | Figure S20 HPLC |
| Summary of Calib.xlsx | 10KB | application/vnd.openxmlformats-officedocument.spreadsheetml.sheet | Figure S21 |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_001-1-Blank.PDF | 183KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_002-D2F-E1-freshCO3.PDF | 152KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_003-D2F-E2-0810MBAd_0p005.PDF | 221KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_004-D2F-E3-0810MBAd_0p01.PDF | 145KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_005-D2F-E4-0810MBAd_0p05.PDF | 146KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_006-D2F-E5-0810MBAd_0p01.PDF | 203KB | application/octet-stream | Figure S21 HPLC |
| 2023-08-10_MBAd_Calib_2uL 2023-08-11 02-05-23_007-D2F-E6-0810MBAd_0p5.PDF | 141KB | application/octet-stream | Figure S21 HPLC |
Member of collection / collaboration
| DOI | Description |
|---|---|
| 10.14469/hpc/13518 | Operando film-electrochemical EPR spectroscopy tracks radical intermediates in surface-immobilised catalysts |
Subject Keywords
| Keyword | Value |
|---|---|
| inchi | InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3 |
| inchikey | KMTDMTZBNYGUNX-UHFFFAOYSA-N |